About bis(2,2-dimethylpropane);3H-pyrrole
bis(2,2-dimethylpropane);3H-pyrrole (PubChem CID 160627240) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is bis(2,2-dimethylpropane);3H-pyrrole.
Molecular Properties
| Compound Name | bis(2,2-dimethylpropane);3H-pyrrole |
| PubChem CID | 160627240 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | bis(2,2-dimethylpropane);3H-pyrrole |
| SMILES | C1=CN=CC1.CC(C)(C)C.CC(C)(C)C |
| InChI | InChI=1S/2C5H12.C4H5N/c2*1-5(2,3)4;1-2-4-5-3-1/h2*1-4H3;1,3-4H,2H2 |
| InChIKey | RHLSFUNRVPZIAT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(2,2-dimethylpropane);3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropane);3H-pyrrole?
The IUPAC name of bis(2,2-dimethylpropane);3H-pyrrole (CID 160627240) is bis(2,2-dimethylpropane);3H-pyrrole.
What is the SMILES notation for bis(2,2-dimethylpropane);3H-pyrrole?
The canonical SMILES for bis(2,2-dimethylpropane);3H-pyrrole is C1=CN=CC1.CC(C)(C)C.CC(C)(C)C.
What is the InChIKey of bis(2,2-dimethylpropane);3H-pyrrole?
The InChIKey is RHLSFUNRVPZIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12.C4H5N/c2*1-5(2,3)4;1-2-4-5-3-1/h2*1-4H3;1,3-4H,2H2.
What are the key properties of bis(2,2-dimethylpropane);3H-pyrrole?
bis(2,2-dimethylpropane);3H-pyrrole has a molecular weight of 211.39 g/mol, XLogP of 5.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropane);3H-pyrrole is sourced from PubChem (CID 160627240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).