C26H22N6O2 — CID 160627290
1-(4-azido-2-hydroxy-5-methylphenyl)-2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]ethanone (PubChem CID 160627290) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-(4-azido-2-hydroxy-5-methylphenyl)-2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]ethanone.
| Compound Name | 1-(4-azido-2-hydroxy-5-methylphenyl)-2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 160627290 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-(4-azido-2-hydroxy-5-methylphenyl)-2-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)methyl]phenyl]ethanone |
| SMILES | Cc1ccc(CC(=O)c2cc(C)c(N=[N+]=[N-])cc2O)cc1Cc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C26H22N6O2/c1-16-5-6-18(12-24(33)21-10-17(2)23(31-32-27)14-25(21)34)11-20(16)13-26-29-9-7-22(30-26)19-4-3-8-28-15-19/h3-11,14-15,34H,12-13H2,1-2H3 |
| InChIKey | WICYZYWNDLYDSY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|