About (E)-N-butyldec-2-enamide
(E)-N-butyldec-2-enamide (PubChem CID 160628271) has the molecular formula C28H54N2O2
and a molecular weight of 450.75 g/mol. Its IUPAC name is (E)-N-butyldec-2-enamide.
Molecular Properties
| Compound Name | (E)-N-butyldec-2-enamide |
| PubChem CID | 160628271 |
| Molecular Formula | C28H54N2O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | (E)-N-butyldec-2-enamide |
| SMILES | CCCCCCC/C=C/C(=O)NCCCC.CCCCCCC/C=C/C(=O)NCCCC |
| InChI | InChI=1S/2C14H27NO/c2*1-3-5-7-8-9-10-11-12-14(16)15-13-6-4-2/h2*11-12H,3-10,13H2,1-2H3,(H,15,16)/b2*12-11+ |
| InChIKey | RHOZHRGCSYIRTE-GACHGFCISA-N |
| XLogP | 7.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-butyldec-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-butyldec-2-enamide?
The IUPAC name of (E)-N-butyldec-2-enamide (CID 160628271) is (E)-N-butyldec-2-enamide.
What is the SMILES notation for (E)-N-butyldec-2-enamide?
The canonical SMILES for (E)-N-butyldec-2-enamide is CCCCCCC/C=C/C(=O)NCCCC.CCCCCCC/C=C/C(=O)NCCCC.
What is the InChIKey of (E)-N-butyldec-2-enamide?
The InChIKey is RHOZHRGCSYIRTE-GACHGFCISA-N. The full InChI is InChI=1S/2C14H27NO/c2*1-3-5-7-8-9-10-11-12-14(16)15-13-6-4-2/h2*11-12H,3-10,13H2,1-2H3,(H,15,16)/b2*12-11+.
What are the key properties of (E)-N-butyldec-2-enamide?
(E)-N-butyldec-2-enamide has a molecular weight of 450.75 g/mol, XLogP of 7.64, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-butyldec-2-enamide is sourced from PubChem (CID 160628271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).