C24H23NO3S2 — CID 160628923
1-ethyl-4-phenylquinolin-1-ium-2-thiol;4-methylbenzenesulfonate (PubChem CID 160628923) has the molecular formula C24H23NO3S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 1-ethyl-4-phenylquinolin-1-ium-2-thiol;4-methylbenzenesulfonate.
| Compound Name | 1-ethyl-4-phenylquinolin-1-ium-2-thiol;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 160628923 |
| Molecular Formula | C24H23NO3S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-ethyl-4-phenylquinolin-1-ium-2-thiol;4-methylbenzenesulfonate |
| SMILES | CC[n+]1c(S)cc(-c2ccccc2)c2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C17H15NS.C7H8O3S/c1-2-18-16-11-7-6-10-14(16)15(12-17(18)19)13-8-4-3-5-9-13;1-6-2-4-7(5-3-6)11(8,9)10/h3-12H,2H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | RHRBOAAODPAOHL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|