C26H25BrN8 — CID 160630587
aniline;7-bromo-2-methylpyrrolo[2,1-f][1,2,4]triazine;2-methyl-N-phenylpyrrolo[2,1-f][1,2,4]triazin-7-amine (PubChem CID 160630587) has the molecular formula C26H25BrN8 and a molecular weight of 529.45 g/mol. Its IUPAC name is aniline;7-bromo-2-methylpyrrolo[2,1-f][1,2,4]triazine;2-methyl-N-phenylpyrrolo[2,1-f][1,2,4]triazin-7-amine.
| Compound Name | aniline;7-bromo-2-methylpyrrolo[2,1-f][1,2,4]triazine;2-methyl-N-phenylpyrrolo[2,1-f][1,2,4]triazin-7-amine |
|---|---|
| PubChem CID | 160630587 |
| Molecular Formula | C26H25BrN8 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | aniline;7-bromo-2-methylpyrrolo[2,1-f][1,2,4]triazine;2-methyl-N-phenylpyrrolo[2,1-f][1,2,4]triazin-7-amine |
| SMILES | Cc1ncc2ccc(Br)n2n1.Cc1ncc2ccc(Nc3ccccc3)n2n1.Nc1ccccc1 |
| InChI | InChI=1S/C13H12N4.C7H6BrN3.C6H7N/c1-10-14-9-12-7-8-13(17(12)16-10)15-11-5-3-2-4-6-11;1-5-9-4-6-2-3-7(8)11(6)10-5;7-6-4-2-1-3-5-6/h2-9,15H,1H3;2-4H,1H3;1-5H,7H2 |
| InChIKey | RHWIIGVZUSKSBA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|