About methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate
methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate (PubChem CID 160630630) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate.
Analyze methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate?
The IUPAC name of methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate (CID 160630630) is methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate.
What is the SMILES notation for methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate?
The canonical SMILES for methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate is COC(=O)N[C@@](C)(C(=O)OC)C(C)C.
What is the InChIKey of methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate?
The InChIKey is RHWMUDZRQAGEOA-SECBINFHSA-N. The full InChI is InChI=1S/C9H17NO4/c1-6(2)9(3,7(11)13-4)10-8(12)14-5/h6H,1-5H3,(H,10,12)/t9-/m1/s1.
What are the key properties of methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate?
methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate has a molecular weight of 203.24 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(methoxycarbonylamino)-2,3-dimethylbutanoate is sourced from PubChem (CID 160630630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).