C24H27N7O6 — CID 160631403
[(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-ethylphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate (PubChem CID 160631403) has the molecular formula C24H27N7O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-ethylphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-ethylphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 160631403 |
| Molecular Formula | C24H27N7O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[8-[(4-ethylphenyl)diazenyl]-2-(methylideneamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] acetate |
| SMILES | C=Nc1nc2c(nc(/N=N/c3ccc(CC)cc3)n2[C@@H]2O[C@H](CC)[C@H](OC(C)=O)C2OC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C24H27N7O6/c1-6-14-8-10-15(11-9-14)29-30-24-26-17-20(27-23(25-5)28-21(17)34)31(24)22-19(36-13(4)33)18(35-12(3)32)16(7-2)37-22/h8-11,16,18-19,22H,5-7H2,1-4H3,(H,27,28,34)/b30-29+/t16-,18+,19?,22-/m1/s1 |
| InChIKey | SMFRNAFFJWKPMD-GJHYPVPESA-N |
| XLogP | 3.60 |
| TPSA | 162.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|