About [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium
[ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium (PubChem CID 160631618) has the molecular formula C18H23O2P2+
and a molecular weight of 333.33 g/mol. Its IUPAC name is [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium.
Molecular Properties
| Compound Name | [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium |
| PubChem CID | 160631618 |
| Molecular Formula | C18H23O2P2+ |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium |
| SMILES | CCP(C(=O)c1c(C)cc(C)cc1C)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C18H21OP.H2OP/c1-5-20(16-9-7-6-8-10-16)18(19)17-14(3)11-13(2)12-15(17)4;1-2/h6-12H,5H2,1-4H3;2H2/q;+1 |
| InChIKey | VWLGIPDUDGTABX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium?
The IUPAC name of [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium (CID 160631618) is [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium.
What is the SMILES notation for [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium?
The canonical SMILES for [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium is CCP(C(=O)c1c(C)cc(C)cc1C)c1ccccc1.O=[PH2+].
What is the InChIKey of [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium?
The InChIKey is VWLGIPDUDGTABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21OP.H2OP/c1-5-20(16-9-7-6-8-10-16)18(19)17-14(3)11-13(2)12-15(17)4;1-2/h6-12H,5H2,1-4H3;2H2/q;+1.
What are the key properties of [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium?
[ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium has a molecular weight of 333.33 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl(phenyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;oxophosphanium is sourced from PubChem (CID 160631618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).