C26H21N3O2 — CID 160631724
2-[[3-(3-cyanophenyl)-1-methylindol-5-yl]methyl]-5-cyclopropylpyridine-3-carboxylic acid (PubChem CID 160631724) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[[3-(3-cyanophenyl)-1-methylindol-5-yl]methyl]-5-cyclopropylpyridine-3-carboxylic acid.
| Compound Name | 2-[[3-(3-cyanophenyl)-1-methylindol-5-yl]methyl]-5-cyclopropylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 160631724 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-[[3-(3-cyanophenyl)-1-methylindol-5-yl]methyl]-5-cyclopropylpyridine-3-carboxylic acid |
| SMILES | Cn1cc(-c2cccc(C#N)c2)c2cc(Cc3ncc(C4CC4)cc3C(=O)O)ccc21 |
| InChI | InChI=1S/C26H21N3O2/c1-29-15-23(19-4-2-3-17(9-19)13-27)21-10-16(5-8-25(21)29)11-24-22(26(30)31)12-20(14-28-24)18-6-7-18/h2-5,8-10,12,14-15,18H,6-7,11H2,1H3,(H,30,31) |
| InChIKey | UXRFAGDOYQXOOK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |