C23H19FN2O2 — CID 160632073
4-(1-but-2-ynoyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-9H-fluorene-1-carboxamide (PubChem CID 160632073) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-(1-but-2-ynoyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-9H-fluorene-1-carboxamide.
| Compound Name | 4-(1-but-2-ynoyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 160632073 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-(1-but-2-ynoyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluoro-9H-fluorene-1-carboxamide |
| SMILES | CC#CC(=O)N1CC=C(c2c(F)cc(C(N)=O)c3c2-c2ccccc2C3)CC1 |
| InChI | InChI=1S/C23H19FN2O2/c1-2-5-20(27)26-10-8-14(9-11-26)21-19(24)13-18(23(25)28)17-12-15-6-3-4-7-16(15)22(17)21/h3-4,6-8,13H,9-12H2,1H3,(H2,25,28) |
| InChIKey | RIATWAFBJNALSC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|