C21H17FN2O2 — CID 160632843
1-fluoro-N-[(3-methoxyphenyl)methyl]-9H-indeno[2,1-c]pyridine-7-carboxamide (PubChem CID 160632843) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-fluoro-N-[(3-methoxyphenyl)methyl]-9H-indeno[2,1-c]pyridine-7-carboxamide.
| Compound Name | 1-fluoro-N-[(3-methoxyphenyl)methyl]-9H-indeno[2,1-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 160632843 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-fluoro-N-[(3-methoxyphenyl)methyl]-9H-indeno[2,1-c]pyridine-7-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2ccc3c(c2)Cc2c-3ccnc2F)c1 |
| InChI | InChI=1S/C21H17FN2O2/c1-26-16-4-2-3-13(9-16)12-24-21(25)14-5-6-17-15(10-14)11-19-18(17)7-8-23-20(19)22/h2-10H,11-12H2,1H3,(H,24,25) |
| InChIKey | RIDKITKXHPLADG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|