About [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate
[4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate (PubChem CID 160633395) has the molecular formula C17H13Cl2N3O2Se
and a molecular weight of 441.18 g/mol. Its IUPAC name is [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate.
Molecular Properties
| Compound Name | [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate |
| PubChem CID | 160633395 |
| Molecular Formula | C17H13Cl2N3O2Se |
| Molecular Weight | 441.18 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate |
| SMILES | [H]/N=C(\N)[Se]Cc1ccc(CN2C(=O)C(=O)c3cc(Cl)cc(Cl)c32)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O2Se/c18-11-5-12-14(13(19)6-11)22(16(24)15(12)23)7-9-1-3-10(4-2-9)8-25-17(20)21/h1-6H,7-8H2,(H3,20,21) |
| InChIKey | RIFGADVJKGVELL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate?
The IUPAC name of [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate (CID 160633395) is [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate.
What is the SMILES notation for [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate?
The canonical SMILES for [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate is [H]/N=C(\N)[Se]Cc1ccc(CN2C(=O)C(=O)c3cc(Cl)cc(Cl)c32)cc1.
What is the InChIKey of [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate?
The InChIKey is RIFGADVJKGVELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2N3O2Se/c18-11-5-12-14(13(19)6-11)22(16(24)15(12)23)7-9-1-3-10(4-2-9)8-25-17(20)21/h1-6H,7-8H2,(H3,20,21).
What are the key properties of [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate?
[4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate has a molecular weight of 441.18 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5,7-dichloro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate is sourced from PubChem (CID 160633395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).