C10H26O3S6 — CID 160633618
(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2,3-bis(sulfanyl)propan-1-ol;propane-1,1-dithiol (PubChem CID 160633618) has the molecular formula C10H26O3S6 and a molecular weight of 386.72 g/mol. Its IUPAC name is (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2,3-bis(sulfanyl)propan-1-ol;propane-1,1-dithiol.
| Compound Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2,3-bis(sulfanyl)propan-1-ol;propane-1,1-dithiol |
|---|---|
| PubChem CID | 160633618 |
| Molecular Formula | C10H26O3S6 |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol;2,3-bis(sulfanyl)propan-1-ol;propane-1,1-dithiol |
| SMILES | CCC(S)S.OCC(S)CS.O[C@H](CS)[C@H](O)CS |
| InChI | InChI=1S/C4H10O2S2.C3H8OS2.C3H8S2/c5-3(1-7)4(6)2-8;4-1-3(6)2-5;1-2-3(4)5/h3-8H,1-2H2;3-6H,1-2H2;3-5H,2H2,1H3/t3-,4-;;/m1../s1 |
| InChIKey | RIFYIDGCHFMGLQ-XWJKVJTJSA-N |
| XLogP | 1.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|