About aluminum;1-nitroethane;trichloride
aluminum;1-nitroethane;trichloride (PubChem CID 160633752) has the molecular formula C2H5AlCl3NO2
and a molecular weight of 208.41 g/mol. Its IUPAC name is aluminum;1-nitroethane;trichloride.
Molecular Properties
| Compound Name | aluminum;1-nitroethane;trichloride |
| PubChem CID | 160633752 |
| Molecular Formula | C2H5AlCl3NO2 |
| Molecular Weight | 208.41 g/mol |
| Exact Mass | 206.92 |
| IUPAC Name | aluminum;1-nitroethane;trichloride |
| SMILES | CC[N+](=O)[O-].[Al+3].[Cl-].[Cl-].[Cl-] |
| InChI | InChI=1S/C2H5NO2.Al.3ClH/c1-2-3(4)5;;;;/h2H2,1H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | RIGKNZWDWYGHNG-UHFFFAOYSA-K |
| XLogP | -9.09 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.41 |
| LogP ≤ 5 | -9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aluminum;1-nitroethane;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;1-nitroethane;trichloride?
The IUPAC name of aluminum;1-nitroethane;trichloride (CID 160633752) is aluminum;1-nitroethane;trichloride.
What is the SMILES notation for aluminum;1-nitroethane;trichloride?
The canonical SMILES for aluminum;1-nitroethane;trichloride is CC[N+](=O)[O-].[Al+3].[Cl-].[Cl-].[Cl-].
What is the InChIKey of aluminum;1-nitroethane;trichloride?
The InChIKey is RIGKNZWDWYGHNG-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H5NO2.Al.3ClH/c1-2-3(4)5;;;;/h2H2,1H3;;3*1H/q;+3;;;/p-3.
What are the key properties of aluminum;1-nitroethane;trichloride?
aluminum;1-nitroethane;trichloride has a molecular weight of 208.41 g/mol, XLogP of -9.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;1-nitroethane;trichloride is sourced from PubChem (CID 160633752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).