C18H26 — CID 160634378
1,2,3,3a,4,5,9,10,10a,10b-decahydropyrene;ethane (PubChem CID 160634378) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,2,3,3a,4,5,9,10,10a,10b-decahydropyrene;ethane.
| Compound Name | 1,2,3,3a,4,5,9,10,10a,10b-decahydropyrene;ethane |
|---|---|
| PubChem CID | 160634378 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,2,3,3a,4,5,9,10,10a,10b-decahydropyrene;ethane |
| SMILES | CC.c1cc2c3c(c1)CCC1CCCC(CC2)C31 |
| InChI | InChI=1S/C16H20.C2H6/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-2/h1,3-4,13-14,16H,2,5-10H2;1-2H3 |
| InChIKey | RIIQYULKOBMWNC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |