C36H45N5O5 — CID 160634486
[5-(5-phenylmethoxypentoxy)-2-pyridinyl]methanamine;6-(5-phenylmethoxypentoxy)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 160634486) has the molecular formula C36H45N5O5 and a molecular weight of 627.79 g/mol. Its IUPAC name is [5-(5-phenylmethoxypentoxy)-2-pyridinyl]methanamine;6-(5-phenylmethoxypentoxy)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | [5-(5-phenylmethoxypentoxy)-2-pyridinyl]methanamine;6-(5-phenylmethoxypentoxy)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 160634486 |
| Molecular Formula | C36H45N5O5 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | [5-(5-phenylmethoxypentoxy)-2-pyridinyl]methanamine;6-(5-phenylmethoxypentoxy)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | NCc1ccc(OCCCCCOCc2ccccc2)cn1.O=c1[nH]nc2ccc(OCCCCCOCc3ccccc3)cn12 |
| InChI | InChI=1S/C18H21N3O3.C18H24N2O2/c22-18-20-19-17-10-9-16(13-21(17)18)24-12-6-2-5-11-23-14-15-7-3-1-4-8-15;19-13-17-9-10-18(14-20-17)22-12-6-2-5-11-21-15-16-7-3-1-4-8-16/h1,3-4,7-10,13H,2,5-6,11-12,14H2,(H,20,22);1,3-4,7-10,14H,2,5-6,11-13,15,19H2 |
| InChIKey | RIJAFAGQGIIQBZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|