About 1,3-dibromobutane;1,3-dibromopropane
1,3-dibromobutane;1,3-dibromopropane (PubChem CID 160634915) has the molecular formula C7H14Br4
and a molecular weight of 417.81 g/mol. Its IUPAC name is 1,3-dibromobutane;1,3-dibromopropane.
Molecular Properties
| Compound Name | 1,3-dibromobutane;1,3-dibromopropane |
| PubChem CID | 160634915 |
| Molecular Formula | C7H14Br4 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 413.78 |
| IUPAC Name | 1,3-dibromobutane;1,3-dibromopropane |
| SMILES | BrCCCBr.CC(Br)CCBr |
| InChI | InChI=1S/C4H8Br2.C3H6Br2/c1-4(6)2-3-5;4-2-1-3-5/h4H,2-3H2,1H3;1-3H2 |
| InChIKey | RIKJABIVRGOFMA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromobutane;1,3-dibromopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromobutane;1,3-dibromopropane?
The IUPAC name of 1,3-dibromobutane;1,3-dibromopropane (CID 160634915) is 1,3-dibromobutane;1,3-dibromopropane.
What is the SMILES notation for 1,3-dibromobutane;1,3-dibromopropane?
The canonical SMILES for 1,3-dibromobutane;1,3-dibromopropane is BrCCCBr.CC(Br)CCBr.
What is the InChIKey of 1,3-dibromobutane;1,3-dibromopropane?
The InChIKey is RIKJABIVRGOFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Br2.C3H6Br2/c1-4(6)2-3-5;4-2-1-3-5/h4H,2-3H2,1H3;1-3H2.
What are the key properties of 1,3-dibromobutane;1,3-dibromopropane?
1,3-dibromobutane;1,3-dibromopropane has a molecular weight of 417.81 g/mol, XLogP of 4.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromobutane;1,3-dibromopropane is sourced from PubChem (CID 160634915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).