About naphthalene;platinum
naphthalene;platinum (PubChem CID 160635011) has the molecular formula C10H8Pt
and a molecular weight of 323.25 g/mol. Its IUPAC name is naphthalene;platinum.
Molecular Properties
| Compound Name | naphthalene;platinum |
| PubChem CID | 160635011 |
| Molecular Formula | C10H8Pt |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | naphthalene;platinum |
| SMILES | [Pt].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.Pt/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-8H; |
| InChIKey | RIKQMTSENJXNFD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze naphthalene;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;platinum?
The IUPAC name of naphthalene;platinum (CID 160635011) is naphthalene;platinum.
What is the SMILES notation for naphthalene;platinum?
The canonical SMILES for naphthalene;platinum is [Pt].c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;platinum?
The InChIKey is RIKQMTSENJXNFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.Pt/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-8H;.
What are the key properties of naphthalene;platinum?
naphthalene;platinum has a molecular weight of 323.25 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;platinum is sourced from PubChem (CID 160635011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).