About 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole
2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole (PubChem CID 160636403) has the molecular formula C19H29N3OS
and a molecular weight of 347.53 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole |
| PubChem CID | 160636403 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1ccc[nH]1.CC(C)c1ncco1.CC(C)c1nccs1 |
| InChI | InChI=1S/C7H11N.C6H9NO.C6H9NS/c1-6(2)7-4-3-5-8-7;2*1-5(2)6-7-3-4-8-6/h3-6,8H,1-2H3;2*3-5H,1-2H3 |
| InChIKey | RIOZZIFASFBTEI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole?
The IUPAC name of 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole (CID 160636403) is 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole.
What is the SMILES notation for 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole?
The canonical SMILES for 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole is CC(C)c1ccc[nH]1.CC(C)c1ncco1.CC(C)c1nccs1.
What is the InChIKey of 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole?
The InChIKey is RIOZZIFASFBTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C6H9NO.C6H9NS/c1-6(2)7-4-3-5-8-7;2*1-5(2)6-7-3-4-8-6/h3-6,8H,1-2H3;2*3-5H,1-2H3.
What are the key properties of 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole?
2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole has a molecular weight of 347.53 g/mol, XLogP of 6.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,3-oxazole;2-propan-2-yl-1H-pyrrole;2-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 160636403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).