C25H26ClN3O3S3 — CID 160636864
1-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-5-chloropentan-2-one (PubChem CID 160636864) has the molecular formula C25H26ClN3O3S3 and a molecular weight of 548.16 g/mol. Its IUPAC name is 1-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-5-chloropentan-2-one.
| Compound Name | 1-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-5-chloropentan-2-one |
|---|---|
| PubChem CID | 160636864 |
| Molecular Formula | C25H26ClN3O3S3 |
| Molecular Weight | 548.16 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | 1-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-5-chloropentan-2-one |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(OCC(=O)CCCCl)cc3)c2c1N |
| InChI | InChI=1S/C25H26ClN3O3S3/c1-2-3-13-35(31)25-22(27)21-19(14-20(29-24(21)34-25)23-28-11-12-33-23)16-6-8-18(9-7-16)32-15-17(30)5-4-10-26/h6-9,11-12,14H,2-5,10,13,15,27H2,1H3 |
| InChIKey | RIQNMOFCEGVXLX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.16 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|