C6H12N4S2 — CID 160637365
5-ethyl-1,3-thiazol-2-amine;thiourea (PubChem CID 160637365) has the molecular formula C6H12N4S2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 5-ethyl-1,3-thiazol-2-amine;thiourea.
| Compound Name | 5-ethyl-1,3-thiazol-2-amine;thiourea |
|---|---|
| PubChem CID | 160637365 |
| Molecular Formula | C6H12N4S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 5-ethyl-1,3-thiazol-2-amine;thiourea |
| SMILES | CCc1cnc(N)s1.NC(N)=S |
| InChI | InChI=1S/C5H8N2S.CH4N2S/c1-2-4-3-7-5(6)8-4;2-1(3)4/h3H,2H2,1H3,(H2,6,7);(H4,2,3,4) |
| InChIKey | RISDUHCAWYYQIC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|