About 1-methoxy-2,2-dimethylpropane
1-methoxy-2,2-dimethylpropane (PubChem CID 160639316) has the molecular formula C18H42O3
and a molecular weight of 306.53 g/mol. Its IUPAC name is 1-methoxy-2,2-dimethylpropane.
Molecular Properties
| Compound Name | 1-methoxy-2,2-dimethylpropane |
| PubChem CID | 160639316 |
| Molecular Formula | C18H42O3 |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.31 |
| IUPAC Name | 1-methoxy-2,2-dimethylpropane |
| SMILES | COCC(C)(C)C.COCC(C)(C)C.COCC(C)(C)C |
| InChI | InChI=1S/3C6H14O/c3*1-6(2,3)5-7-4/h3*5H2,1-4H3 |
| InChIKey | RIYQDIAQWQAOTL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,2-dimethylpropane?
The IUPAC name of 1-methoxy-2,2-dimethylpropane (CID 160639316) is 1-methoxy-2,2-dimethylpropane.
What is the SMILES notation for 1-methoxy-2,2-dimethylpropane?
The canonical SMILES for 1-methoxy-2,2-dimethylpropane is COCC(C)(C)C.COCC(C)(C)C.COCC(C)(C)C.
What is the InChIKey of 1-methoxy-2,2-dimethylpropane?
The InChIKey is RIYQDIAQWQAOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H14O/c3*1-6(2,3)5-7-4/h3*5H2,1-4H3.
What are the key properties of 1-methoxy-2,2-dimethylpropane?
1-methoxy-2,2-dimethylpropane has a molecular weight of 306.53 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,2-dimethylpropane is sourced from PubChem (CID 160639316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).