About gold(3+) arsorite
gold(3+) arsorite (PubChem CID 160639518) has the molecular formula AsAuO3
and a molecular weight of 319.89 g/mol. Its IUPAC name is gold(3+) arsorite.
Molecular Properties
| Compound Name | gold(3+) arsorite |
| PubChem CID | 160639518 |
| Molecular Formula | AsAuO3 |
| Molecular Weight | 319.89 g/mol |
| Exact Mass | 319.87 |
| IUPAC Name | gold(3+) arsorite |
| SMILES | [Au+3].[O-][As]([O-])[O-] |
| InChI | InChI=1S/AsO3.Au/c2-1(3)4;/q-3;+3 |
| InChIKey | RIZJUBDYHRABIA-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.89 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze gold(3+) arsorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(3+) arsorite?
The IUPAC name of gold(3+) arsorite (CID 160639518) is gold(3+) arsorite.
What is the SMILES notation for gold(3+) arsorite?
The canonical SMILES for gold(3+) arsorite is [Au+3].[O-][As]([O-])[O-].
What is the InChIKey of gold(3+) arsorite?
The InChIKey is RIZJUBDYHRABIA-UHFFFAOYSA-N. The full InChI is InChI=1S/AsO3.Au/c2-1(3)4;/q-3;+3.
What are the key properties of gold(3+) arsorite?
gold(3+) arsorite has a molecular weight of 319.89 g/mol, XLogP of -3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for gold(3+) arsorite is sourced from PubChem (CID 160639518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).