C28H29FN6O6S — CID 160639598
31-fluoro-10-methyl-21,21-dioxo-34-oxa-21λ6-thia-8,12,20,27,29,32-hexazapentacyclo[26.3.1.13,7.16,10.122,26]pentatriaconta-1(32),3(35),4,6,22,24,26(33),28,30-nonaene-9,11,17-trione (PubChem CID 160639598) has the molecular formula C28H29FN6O6S and a molecular weight of 596.64 g/mol. Its IUPAC name is 31-fluoro-10-methyl-21,21-dioxo-34-oxa-21λ6-thia-8,12,20,27,29,32-hexazapentacyclo[26.3.1.13,7.16,10.122,26]pentatriaconta-1(32),3(35),4,6,22,24,26(33),28,30-nonaene-9,11,17-trione.
| Compound Name | 31-fluoro-10-methyl-21,21-dioxo-34-oxa-21λ6-thia-8,12,20,27,29,32-hexazapentacyclo[26.3.1.13,7.16,10.122,26]pentatriaconta-1(32),3(35),4,6,22,24,26(33),28,30-nonaene-9,11,17-trione |
|---|---|
| PubChem CID | 160639598 |
| Molecular Formula | C28H29FN6O6S |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 31-fluoro-10-methyl-21,21-dioxo-34-oxa-21λ6-thia-8,12,20,27,29,32-hexazapentacyclo[26.3.1.13,7.16,10.122,26]pentatriaconta-1(32),3(35),4,6,22,24,26(33),28,30-nonaene-9,11,17-trione |
| SMILES | CC12Oc3ccc(cc3NC1=O)Cc1nc(ncc1F)Nc1cccc(c1)S(=O)(=O)NCCC(=O)CCCCNC2=O |
| InChI | InChI=1S/C28H29FN6O6S/c1-28-25(37)30-11-3-2-6-19(36)10-12-32-42(39,40)20-7-4-5-18(15-20)33-27-31-16-21(29)22(35-27)13-17-8-9-24(41-28)23(14-17)34-26(28)38/h4-5,7-9,14-16,32H,2-3,6,10-13H2,1H3,(H,30,37)(H,34,38)(H,31,33,35) |
| InChIKey | RIZPEDSFFDXUET-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 168.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|