C21H29FN2O2 — CID 160640045
1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-ol;methane (PubChem CID 160640045) has the molecular formula C21H29FN2O2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-ol;methane.
| Compound Name | 1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-ol;methane |
|---|---|
| PubChem CID | 160640045 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-ol;methane |
| SMILES | C.COc1ccccc1N1CCN(C(C)C(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H25FN2O2.CH4/c1-15(20(24)16-7-9-17(21)10-8-16)22-11-13-23(14-12-22)18-5-3-4-6-19(18)25-2;/h3-10,15,20,24H,11-14H2,1-2H3;1H4 |
| InChIKey | RJBBXJMDYUOMMA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |