About 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine
1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine (PubChem CID 160640449) has the molecular formula C24H19I2N3O3
and a molecular weight of 651.24 g/mol. Its IUPAC name is 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine.
Molecular Properties
| Compound Name | 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine |
| PubChem CID | 160640449 |
| Molecular Formula | C24H19I2N3O3 |
| Molecular Weight | 651.24 g/mol |
| Exact Mass | 650.95 |
| IUPAC Name | 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine |
| SMILES | CN=C=O.II.O=C=Nc1ccc(Cc2ccc(Cc3ccc(N=C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H16N2O2.C2H3NO.I2/c25-15-23-21-9-5-19(6-10-21)13-17-1-2-18(4-3-17)14-20-7-11-22(12-8-20)24-16-26;1-3-2-4;1-2/h1-12H,13-14H2;1H3; |
| InChIKey | RJCIKUABYQNRDY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.24 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine?
The IUPAC name of 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine (CID 160640449) is 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine.
What is the SMILES notation for 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine?
The canonical SMILES for 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine is CN=C=O.II.O=C=Nc1ccc(Cc2ccc(Cc3ccc(N=C=O)cc3)cc2)cc1.
What is the InChIKey of 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine?
The InChIKey is RJCIKUABYQNRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O2.C2H3NO.I2/c25-15-23-21-9-5-19(6-10-21)13-17-1-2-18(4-3-17)14-20-7-11-22(12-8-20)24-16-26;1-3-2-4;1-2/h1-12H,13-14H2;1H3;.
What are the key properties of 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine?
1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine has a molecular weight of 651.24 g/mol, XLogP of 6.53, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[(4-isocyanatophenyl)methyl]benzene;methylimino(oxo)methane;molecular iodine is sourced from PubChem (CID 160640449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).