C39H36O7P2 — CID 160640648
dihydroxyphosphanyl dihydrogen phosphite;1,1,2,3,3,3-hexakis-phenylpropane-1,2-diol (PubChem CID 160640648) has the molecular formula C39H36O7P2 and a molecular weight of 678.66 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;1,1,2,3,3,3-hexakis-phenylpropane-1,2-diol.
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;1,1,2,3,3,3-hexakis-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 160640648 |
| Molecular Formula | C39H36O7P2 |
| Molecular Weight | 678.66 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;1,1,2,3,3,3-hexakis-phenylpropane-1,2-diol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C(O)(c1ccccc1)C(c1ccccc1)(c1ccccc1)c1ccccc1.OP(O)OP(O)O |
| InChI | InChI=1S/C39H32O2.H4O5P2/c40-38(34-25-13-4-14-26-34,35-27-15-5-16-28-35)39(41,36-29-17-6-18-30-36)37(31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33;1-6(2)5-7(3)4/h1-30,40-41H;1-4H |
| InChIKey | RJCZMCMWXOSNBT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|