C10H30O3Si4 — CID 160640926
2,2,4,4-tetramethyl-1,3,2,4-dioxadisiletane;trimethyl(trimethylsilyloxy)silane (PubChem CID 160640926) has the molecular formula C10H30O3Si4 and a molecular weight of 310.69 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-1,3,2,4-dioxadisiletane;trimethyl(trimethylsilyloxy)silane.
| Compound Name | 2,2,4,4-tetramethyl-1,3,2,4-dioxadisiletane;trimethyl(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 160640926 |
| Molecular Formula | C10H30O3Si4 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2,2,4,4-tetramethyl-1,3,2,4-dioxadisiletane;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.C[Si]1(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C6H18OSi2.C4H12O2Si2/c1-8(2,3)7-9(4,5)6;1-7(2)5-8(3,4)6-7/h1-6H3;1-4H3 |
| InChIKey | RJDVWSMOVCYZAH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|