C25H32INO — CID 160641765
2-benzyl-1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]-3-phenylpropan-2-ol iodide (PubChem CID 160641765) has the molecular formula C25H32INO and a molecular weight of 489.44 g/mol. Its IUPAC name is 2-benzyl-1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]-3-phenylpropan-2-ol iodide.
| Compound Name | 2-benzyl-1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]-3-phenylpropan-2-ol iodide |
|---|---|
| PubChem CID | 160641765 |
| Molecular Formula | C25H32INO |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-benzyl-1-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]-3-phenylpropan-2-ol iodide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1C/C(=C\C(O)(Cc1ccccc1)Cc1ccccc1)C2.[I-] |
| InChI | InChI=1S/C25H32NO.HI/c1-26(2)23-13-14-24(26)16-22(15-23)19-25(27,17-20-9-5-3-6-10-20)18-21-11-7-4-8-12-21;/h3-12,19,23-24,27H,13-18H2,1-2H3;1H/q+1;/p-1/b22-19-;/t23-,24+;/m1./s1 |
| InChIKey | PQZAQCOGMGANAE-KXPLUCGTSA-M |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|