C12H13F14NO — CID 160642141
1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methyl-N,2-bis(trifluoromethyl)butan-1-amine (PubChem CID 160642141) has the molecular formula C12H13F14NO and a molecular weight of 453.21 g/mol. Its IUPAC name is 1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methyl-N,2-bis(trifluoromethyl)butan-1-amine.
| Compound Name | 1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methyl-N,2-bis(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 160642141 |
| Molecular Formula | C12H13F14NO |
| Molecular Weight | 453.21 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methyl-N,2-bis(trifluoromethyl)butan-1-amine |
| SMILES | CC(OC(C)C(F)(C(F)N(C)C(F)(F)F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F14NO/c1-4(28-5(2)9(16,17)6(13)10(18,19)20)8(15,11(21,22)23)7(14)27(3)12(24,25)26/h4-7H,1-3H3 |
| InChIKey | TVSOFYLWVWKUPB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|