About 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane
4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane (PubChem CID 160642242) has the molecular formula C24H48O7
and a molecular weight of 448.64 g/mol. Its IUPAC name is 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane |
| PubChem CID | 160642242 |
| Molecular Formula | C24H48O7 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane |
| SMILES | CCC(C)O.CCC(CC(C)OC(C)=O)OC(C)=O.CCCC1OC(C)CC(CC)O1 |
| InChI | InChI=1S/C10H18O4.C10H20O2.C4H10O/c1-5-10(14-9(4)12)6-7(2)13-8(3)11;1-4-6-10-11-8(3)7-9(5-2)12-10;1-3-4(2)5/h7,10H,5-6H2,1-4H3;8-10H,4-7H2,1-3H3;4-5H,3H2,1-2H3 |
| InChIKey | RJIDWANCFIHAAT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane?
The IUPAC name of 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane (CID 160642242) is 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane.
What is the SMILES notation for 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane?
The canonical SMILES for 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane is CCC(C)O.CCC(CC(C)OC(C)=O)OC(C)=O.CCCC1OC(C)CC(CC)O1.
What is the InChIKey of 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane?
The InChIKey is RJIDWANCFIHAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.C10H20O2.C4H10O/c1-5-10(14-9(4)12)6-7(2)13-8(3)11;1-4-6-10-11-8(3)7-9(5-2)12-10;1-3-4(2)5/h7,10H,5-6H2,1-4H3;8-10H,4-7H2,1-3H3;4-5H,3H2,1-2H3.
What are the key properties of 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane?
4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane has a molecular weight of 448.64 g/mol, XLogP of 5.16, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyloxyhexan-2-yl acetate;butan-2-ol;4-ethyl-6-methyl-2-propyl-1,3-dioxane is sourced from PubChem (CID 160642242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).