About 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane
1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane (PubChem CID 160642335) has the molecular formula C18H21Cl2N3
and a molecular weight of 350.29 g/mol. Its IUPAC name is 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane.
Molecular Properties
| Compound Name | 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane |
| PubChem CID | 160642335 |
| Molecular Formula | C18H21Cl2N3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane |
| SMILES | CC.Clc1cccc(C2CC2)c1.[N-]=[N+]=NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H9Cl.C7H6ClN3.C2H6/c10-9-3-1-2-8(6-9)7-4-5-7;8-7-3-1-2-6(4-7)5-10-11-9;1-2/h1-3,6-7H,4-5H2;1-4H,5H2;1-2H3 |
| InChIKey | RJINMXFZHRHGRO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane?
The IUPAC name of 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane (CID 160642335) is 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane.
What is the SMILES notation for 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane?
The canonical SMILES for 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane is CC.Clc1cccc(C2CC2)c1.[N-]=[N+]=NCc1cccc(Cl)c1.
What is the InChIKey of 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane?
The InChIKey is RJINMXFZHRHGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl.C7H6ClN3.C2H6/c10-9-3-1-2-8(6-9)7-4-5-7;8-7-3-1-2-6(4-7)5-10-11-9;1-2/h1-3,6-7H,4-5H2;1-4H,5H2;1-2H3.
What are the key properties of 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane?
1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane has a molecular weight of 350.29 g/mol, XLogP of 7.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azidomethyl)-3-chlorobenzene;1-chloro-3-cyclopropylbenzene;ethane is sourced from PubChem (CID 160642335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).