C60H100N20 — CID 160643665
1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane;1,4,7,10-tetrakis(pyrazin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 160643665) has the molecular formula C60H100N20 and a molecular weight of 1101.60 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane;1,4,7,10-tetrakis(pyrazin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane;1,4,7,10-tetrakis(pyrazin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 160643665 |
| Molecular Formula | C60H100N20 |
| Molecular Weight | 1101.60 g/mol |
| Exact Mass | 1100.84 |
| IUPAC Name | 1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane;1,4,7,10-tetrakis(pyrazin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | C1CCC(CN2CCN(CC3CCCCN3)CCN(CC3CCCCN3)CCN(CC3CCCCN3)CC2)NC1.c1cnc(CN2CCN(Cc3cnccn3)CCN(Cc3cnccn3)CCN(Cc3cnccn3)CC2)cn1 |
| InChI | InChI=1S/C32H64N8.C28H36N12/c1-5-13-33-29(9-1)25-37-17-19-38(26-30-10-2-6-14-34-30)21-23-40(28-32-12-4-8-16-36-32)24-22-39(20-18-37)27-31-11-3-7-15-35-31;1-5-33-25(17-29-1)21-37-9-11-38(22-26-18-30-2-6-34-26)13-15-40(24-28-20-32-4-8-36-28)16-14-39(12-10-37)23-27-19-31-3-7-35-27/h29-36H,1-28H2;1-8,17-20H,9-16,21-24H2 |
| InChIKey | RJMWMOJSOKSSJN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 177.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |