C31H38Cl2O11S2 — CID 160644230
1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)butane-1,3-dione;1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)-2-(ethoxymethylidene)butane-1,3-dione (PubChem CID 160644230) has the molecular formula C31H38Cl2O11S2 and a molecular weight of 721.67 g/mol. Its IUPAC name is 1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)butane-1,3-dione;1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)-2-(ethoxymethylidene)butane-1,3-dione.
| Compound Name | 1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)butane-1,3-dione;1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)-2-(ethoxymethylidene)butane-1,3-dione |
|---|---|
| PubChem CID | 160644230 |
| Molecular Formula | C31H38Cl2O11S2 |
| Molecular Weight | 721.67 g/mol |
| Exact Mass | 720.12 |
| IUPAC Name | 1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)butane-1,3-dione;1-(2-chloro-3-ethoxy-4-ethylsulfonylphenyl)-2-(ethoxymethylidene)butane-1,3-dione |
| SMILES | CCOC=C(C(C)=O)C(=O)c1ccc(S(=O)(=O)CC)c(OCC)c1Cl.CCOc1c(S(=O)(=O)CC)ccc(C(=O)CC(C)=O)c1Cl |
| InChI | InChI=1S/C17H21ClO6S.C14H17ClO5S/c1-5-23-10-13(11(4)19)16(20)12-8-9-14(25(21,22)7-3)17(15(12)18)24-6-2;1-4-20-14-12(21(18,19)5-2)7-6-10(13(14)15)11(17)8-9(3)16/h8-10H,5-7H2,1-4H3;6-7H,4-5,8H2,1-3H3 |
| InChIKey | RJOOBJHAXIOERH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|