About 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane
2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane (PubChem CID 160645159) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane.
Molecular Properties
| Compound Name | 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane |
| PubChem CID | 160645159 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane |
| SMILES | CC.CC(C)(C)c1cc2n(n1)COc1ccccc1-2 |
| InChI | InChI=1S/C14H16N2O.C2H6/c1-14(2,3)13-8-11-10-6-4-5-7-12(10)17-9-16(11)15-13;1-2/h4-8H,9H2,1-3H3;1-2H3 |
| InChIKey | RJROVZGSDDEFIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane?
The IUPAC name of 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane (CID 160645159) is 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane.
What is the SMILES notation for 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane?
The canonical SMILES for 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane is CC.CC(C)(C)c1cc2n(n1)COc1ccccc1-2.
What is the InChIKey of 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane?
The InChIKey is RJROVZGSDDEFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O.C2H6/c1-14(2,3)13-8-11-10-6-4-5-7-12(10)17-9-16(11)15-13;1-2/h4-8H,9H2,1-3H3;1-2H3.
What are the key properties of 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane?
2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane has a molecular weight of 258.36 g/mol, XLogP of 4.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5H-pyrazolo[1,5-c][1,3]benzoxazine;ethane is sourced from PubChem (CID 160645159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).