About 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran
4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran (PubChem CID 160646898) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran |
| PubChem CID | 160646898 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran |
| SMILES | C.CC(C)(C)CN1CCOCC1.CC(C)C1=CCOCC1 |
| InChI | InChI=1S/C9H19NO.C8H14O.CH4/c1-9(2,3)8-10-4-6-11-7-5-10;1-7(2)8-3-5-9-6-4-8;/h4-8H2,1-3H3;3,7H,4-6H2,1-2H3;1H4 |
| InChIKey | RJWZUXHITGHLJT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran?
The IUPAC name of 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran (CID 160646898) is 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran?
The canonical SMILES for 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran is C.CC(C)(C)CN1CCOCC1.CC(C)C1=CCOCC1.
What is the InChIKey of 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran?
The InChIKey is RJWZUXHITGHLJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C8H14O.CH4/c1-9(2,3)8-10-4-6-11-7-5-10;1-7(2)8-3-5-9-6-4-8;/h4-8H2,1-3H3;3,7H,4-6H2,1-2H3;1H4.
What are the key properties of 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran?
4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran has a molecular weight of 299.50 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropyl)morpholine;methane;4-propan-2-yl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 160646898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).