C23H20Cl3F26NO2S2 — CID 160648075
molecular chlorine;7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octane-1-sulfonyl chloride;[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl] thiocyanate (PubChem CID 160648075) has the molecular formula C23H20Cl3F26NO2S2 and a molecular weight of 1006.86 g/mol. Its IUPAC name is molecular chlorine;7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octane-1-sulfonyl chloride;[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl] thiocyanate.
| Compound Name | molecular chlorine;7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octane-1-sulfonyl chloride;[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl] thiocyanate |
|---|---|
| PubChem CID | 160648075 |
| Molecular Formula | C23H20Cl3F26NO2S2 |
| Molecular Weight | 1006.86 g/mol |
| Exact Mass | 1004.96 |
| IUPAC Name | molecular chlorine;7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octane-1-sulfonyl chloride;[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl] thiocyanate |
| SMILES | ClCl.N#CSCCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F.O=S(=O)(Cl)CCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F13NS.C11H10ClF13O2S.Cl2/c13-8(11(20,21)22,12(23,24)25)4-7(10(17,18)19)3-6(9(14,15)16)1-2-27-5-26;12-28(26,27)2-1-5(8(14,15)16)3-6(9(17,18)19)4-7(13,10(20,21)22)11(23,24)25;1-2/h6-7H,1-4H2;5-6H,1-4H2; |
| InChIKey | RKBAREYOLPHYIO-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.86 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|