C46H39BrN8O2 — CID 160648110
2-bromo-1-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]ethanone;2-(1-ethoxyethenyl)-5-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine (PubChem CID 160648110) has the molecular formula C46H39BrN8O2 and a molecular weight of 815.78 g/mol. Its IUPAC name is 2-bromo-1-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]ethanone;2-(1-ethoxyethenyl)-5-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 2-bromo-1-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]ethanone;2-(1-ethoxyethenyl)-5-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 160648110 |
| Molecular Formula | C46H39BrN8O2 |
| Molecular Weight | 815.78 g/mol |
| Exact Mass | 814.24 |
| IUPAC Name | 2-bromo-1-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]ethanone;2-(1-ethoxyethenyl)-5-phenyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine |
| SMILES | C=C(OCC)c1nc(NCc2ccccn2)c2c(-c3ccccc3)cccc2n1.O=C(CBr)c1nc(NCc2ccccn2)c2c(-c3ccccc3)cccc2n1 |
| InChI | InChI=1S/C24H22N4O.C22H17BrN4O/c1-3-29-17(2)23-27-21-14-9-13-20(18-10-5-4-6-11-18)22(21)24(28-23)26-16-19-12-7-8-15-25-19;23-13-19(28)21-26-18-11-6-10-17(15-7-2-1-3-8-15)20(18)22(27-21)25-14-16-9-4-5-12-24-16/h4-15H,2-3,16H2,1H3,(H,26,27,28);1-12H,13-14H2,(H,25,26,27) |
| InChIKey | RKBCUAPLJZZCBY-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.78 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|