About [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid
[2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid (PubChem CID 160648793) has the molecular formula C27H24ClIN2O5
and a molecular weight of 618.86 g/mol. Its IUPAC name is [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid.
Molecular Properties
| Compound Name | [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid |
| PubChem CID | 160648793 |
| Molecular Formula | C27H24ClIN2O5 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.04 |
| IUPAC Name | [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid |
| SMILES | O=C(O)c1ccccc1I(=O)=O.O=C(c1c2ccccc2nn1-c1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H19ClN2O.C7H5IO4/c21-15-10-12-16(13-11-15)23-19(17-8-4-5-9-18(17)22-23)20(24)14-6-2-1-3-7-14;9-7(10)5-3-1-2-4-6(5)8(11)12/h4-5,8-14H,1-3,6-7H2;1-4H,(H,9,10) |
| InChIKey | RKDJIRHUNZUKIF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid?
The IUPAC name of [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid (CID 160648793) is [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid.
What is the SMILES notation for [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid?
The canonical SMILES for [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid is O=C(O)c1ccccc1I(=O)=O.O=C(c1c2ccccc2nn1-c1ccc(Cl)cc1)C1CCCCC1.
What is the InChIKey of [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid?
The InChIKey is RKDJIRHUNZUKIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O.C7H5IO4/c21-15-10-12-16(13-11-15)23-19(17-8-4-5-9-18(17)22-23)20(24)14-6-2-1-3-7-14;9-7(10)5-3-1-2-4-6(5)8(11)12/h4-5,8-14H,1-3,6-7H2;1-4H,(H,9,10).
What are the key properties of [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid?
[2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid has a molecular weight of 618.86 g/mol, XLogP of 7.19, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-chlorophenyl)indazol-3-yl]-cyclohexylmethanone;2-iodylbenzoic acid is sourced from PubChem (CID 160648793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).