About 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde
4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde (PubChem CID 160649818) has the molecular formula C24H20N4O
and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde |
| PubChem CID | 160649818 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde |
| SMILES | Cc1cccc(-c2ccc(/N=N/c3cc(C=O)c4ccccc4c3N)cn2)c1C |
| InChI | InChI=1S/C24H20N4O/c1-15-6-5-9-19(16(15)2)22-11-10-18(13-26-22)27-28-23-12-17(14-29)20-7-3-4-8-21(20)24(23)25/h3-14H,25H2,1-2H3/b28-27+ |
| InChIKey | RKGRIRHWJWALQT-BYYHNAKLSA-N |
| XLogP | 6.33 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde?
The IUPAC name of 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde (CID 160649818) is 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde.
What is the SMILES notation for 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde?
The canonical SMILES for 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde is Cc1cccc(-c2ccc(/N=N/c3cc(C=O)c4ccccc4c3N)cn2)c1C.
What is the InChIKey of 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde?
The InChIKey is RKGRIRHWJWALQT-BYYHNAKLSA-N. The full InChI is InChI=1S/C24H20N4O/c1-15-6-5-9-19(16(15)2)22-11-10-18(13-26-22)27-28-23-12-17(14-29)20-7-3-4-8-21(20)24(23)25/h3-14H,25H2,1-2H3/b28-27+.
What are the key properties of 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde?
4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde has a molecular weight of 380.45 g/mol, XLogP of 6.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-[[6-(2,3-dimethylphenyl)-3-pyridinyl]diazenyl]naphthalene-1-carbaldehyde is sourced from PubChem (CID 160649818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).