C12H26N2O14 — CID 160650104
azanium;(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;nitrate (PubChem CID 160650104) has the molecular formula C12H26N2O14 and a molecular weight of 422.34 g/mol. Its IUPAC name is azanium;(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;nitrate.
| Compound Name | azanium;(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;nitrate |
|---|---|
| PubChem CID | 160650104 |
| Molecular Formula | C12H26N2O14 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | azanium;(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;nitrate |
| SMILES | O=[N+]([O-])[O-].OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O.[NH4+] |
| InChI | InChI=1S/C12H22O11.NO3.H3N/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17;2-1(3)4;/h3-20H,1-2H2;;1H3/q;-1;/p+1/t3-,4-,5+,6+,7-,8-,9-,10-,11?,12+;;/m1../s1 |
| InChIKey | RKHOINKGMVBYLG-GTDRIFFSSA-O |
| XLogP | -5.26 |
| TPSA | 292.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|