About 2H-chromene;propane
2H-chromene;propane (PubChem CID 160650237) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2H-chromene;propane.
Molecular Properties
| Compound Name | 2H-chromene;propane |
| PubChem CID | 160650237 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2H-chromene;propane |
| SMILES | C1=Cc2ccccc2OC1.CCC |
| InChI | InChI=1S/C9H8O.C3H8/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h1-6H,7H2;3H2,1-2H3 |
| InChIKey | RKIAFTFVVUJDPS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-chromene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;propane?
The IUPAC name of 2H-chromene;propane (CID 160650237) is 2H-chromene;propane.
What is the SMILES notation for 2H-chromene;propane?
The canonical SMILES for 2H-chromene;propane is C1=Cc2ccccc2OC1.CCC.
What is the InChIKey of 2H-chromene;propane?
The InChIKey is RKIAFTFVVUJDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C3H8/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h1-6H,7H2;3H2,1-2H3.
What are the key properties of 2H-chromene;propane?
2H-chromene;propane has a molecular weight of 176.26 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;propane is sourced from PubChem (CID 160650237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).