About tetrabutylphosphanium;tin(4+)
tetrabutylphosphanium;tin(4+) (PubChem CID 160650774) has the molecular formula C16H36PSn+5
and a molecular weight of 378.15 g/mol. Its IUPAC name is tetrabutylphosphanium;tin(4+).
Molecular Properties
| Compound Name | tetrabutylphosphanium;tin(4+) |
| PubChem CID | 160650774 |
| Molecular Formula | C16H36PSn+5 |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | tetrabutylphosphanium;tin(4+) |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.[Sn+4] |
| InChI | InChI=1S/C16H36P.Sn/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;/q+1;+4 |
| InChIKey | RKJQTPXJXRZKLI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylphosphanium;tin(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylphosphanium;tin(4+)?
The IUPAC name of tetrabutylphosphanium;tin(4+) (CID 160650774) is tetrabutylphosphanium;tin(4+).
What is the SMILES notation for tetrabutylphosphanium;tin(4+)?
The canonical SMILES for tetrabutylphosphanium;tin(4+) is CCCC[P+](CCCC)(CCCC)CCCC.[Sn+4].
What is the InChIKey of tetrabutylphosphanium;tin(4+)?
The InChIKey is RKJQTPXJXRZKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.Sn/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;/q+1;+4.
What are the key properties of tetrabutylphosphanium;tin(4+)?
tetrabutylphosphanium;tin(4+) has a molecular weight of 378.15 g/mol, XLogP of 5.82, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylphosphanium;tin(4+) is sourced from PubChem (CID 160650774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).