C26H40N6O2 — CID 160652027
1,3,4,5-tetramethyl-2,6-dimethylidenepyrimidine;1,3,5,6-tetramethylpyrazin-2-one;2,3,5,6-tetramethylpyrimidin-4-one (PubChem CID 160652027) has the molecular formula C26H40N6O2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-2,6-dimethylidenepyrimidine;1,3,5,6-tetramethylpyrazin-2-one;2,3,5,6-tetramethylpyrimidin-4-one.
| Compound Name | 1,3,4,5-tetramethyl-2,6-dimethylidenepyrimidine;1,3,5,6-tetramethylpyrazin-2-one;2,3,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 160652027 |
| Molecular Formula | C26H40N6O2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1,3,4,5-tetramethyl-2,6-dimethylidenepyrimidine;1,3,5,6-tetramethylpyrazin-2-one;2,3,5,6-tetramethylpyrimidin-4-one |
| SMILES | C=C1C(C)=C(C)N(C)C(=C)N1C.Cc1nc(C)c(=O)n(C)c1C.Cc1nc(C)n(C)c(=O)c1C |
| InChI | InChI=1S/C10H16N2.2C8H12N2O/c1-7-8(2)11(5)10(4)12(6)9(7)3;1-5-7(3)10(4)8(11)6(2)9-5;1-5-6(2)9-7(3)10(4)8(5)11/h2,4H2,1,3,5-6H3;2*1-4H3 |
| InChIKey | RKNXLTVPAXJZEJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |