About 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane
1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane (PubChem CID 160652387) has the molecular formula C17H16N2O4
and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane.
Molecular Properties
| Compound Name | 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane |
| PubChem CID | 160652387 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane |
| SMILES | CCC.O=C1C=CC(=O)N1c1cccc(N2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C14H8N2O4.C3H8/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20;1-3-2/h1-8H;3H2,1-2H3 |
| InChIKey | RKPDSKNNBPZGKY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane?
The IUPAC name of 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane (CID 160652387) is 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane.
What is the SMILES notation for 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane?
The canonical SMILES for 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane is CCC.O=C1C=CC(=O)N1c1cccc(N2C(=O)C=CC2=O)c1.
What is the InChIKey of 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane?
The InChIKey is RKPDSKNNBPZGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O4.C3H8/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20;1-3-2/h1-8H;3H2,1-2H3.
What are the key properties of 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane?
1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane has a molecular weight of 312.33 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione;propane is sourced from PubChem (CID 160652387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).