C28H25ClN6O5 — CID 160653658
formic acid;methyl 2-[4-[2-[[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]methyl]-5-methyl-3H-pyrrol-4-yl]phenyl]acetate (PubChem CID 160653658) has the molecular formula C28H25ClN6O5 and a molecular weight of 561.00 g/mol. Its IUPAC name is formic acid;methyl 2-[4-[2-[[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]methyl]-5-methyl-3H-pyrrol-4-yl]phenyl]acetate.
| Compound Name | formic acid;methyl 2-[4-[2-[[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]methyl]-5-methyl-3H-pyrrol-4-yl]phenyl]acetate |
|---|---|
| PubChem CID | 160653658 |
| Molecular Formula | C28H25ClN6O5 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | formic acid;methyl 2-[4-[2-[[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2-oxo-1-pyridinyl]methyl]-5-methyl-3H-pyrrol-4-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(C2=C(C)N=C(Cn3ccc(-c4cc(Cl)ccc4-n4cnnn4)cc3=O)C2)cc1.O=CO |
| InChI | InChI=1S/C27H23ClN6O3.CH2O2/c1-17-23(19-5-3-18(4-6-19)11-27(36)37-2)14-22(30-17)15-33-10-9-20(12-26(33)35)24-13-21(28)7-8-25(24)34-16-29-31-32-34;2-1-3/h3-10,12-13,16H,11,14-15H2,1-2H3;1H,(H,2,3) |
| InChIKey | RKTHNVJTWPJXQO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|