C34H26N4O6 — CID 160654131
1-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3H-isoindol-5-amine;3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-nitro-1H-isoindole (PubChem CID 160654131) has the molecular formula C34H26N4O6 and a molecular weight of 586.60 g/mol. Its IUPAC name is 1-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3H-isoindol-5-amine;3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-nitro-1H-isoindole.
| Compound Name | 1-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3H-isoindol-5-amine;3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-nitro-1H-isoindole |
|---|---|
| PubChem CID | 160654131 |
| Molecular Formula | C34H26N4O6 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 1-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3H-isoindol-5-amine;3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-6-nitro-1H-isoindole |
| SMILES | Nc1ccc2c(c1)CN=C2/C=C/c1ccc2c(c1)OCO2.O=[N+]([O-])c1ccc2c(c1)CN=C2/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H12N2O4.C17H14N2O2/c20-19(21)13-3-4-14-12(8-13)9-18-15(14)5-1-11-2-6-16-17(7-11)23-10-22-16;18-13-3-4-14-12(8-13)9-19-15(14)5-1-11-2-6-16-17(7-11)21-10-20-16/h1-8H,9-10H2;1-8H,9-10,18H2/b2*5-1+ |
| InChIKey | RKUXOYLQTNUUCM-CIFSXEGYSA-N |
| XLogP | 6.35 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|