About 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride
6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride (PubChem CID 160654667) has the molecular formula C13H11BrCl4NO3P
and a molecular weight of 481.93 g/mol. Its IUPAC name is 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride.
Molecular Properties
| Compound Name | 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride |
| PubChem CID | 160654667 |
| Molecular Formula | C13H11BrCl4NO3P |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 478.84 |
| IUPAC Name | 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride |
| SMILES | O=Cc1cn(CCCCl)c(=O)c2ccc(Br)cc12.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H11BrClNO2.Cl3OP/c14-10-2-3-11-12(6-10)9(8-17)7-16(13(11)18)5-1-4-15;1-5(2,3)4/h2-3,6-8H,1,4-5H2; |
| InChIKey | RKWSRKYWJSGSKS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride?
The IUPAC name of 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride (CID 160654667) is 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride.
What is the SMILES notation for 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride?
The canonical SMILES for 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride is O=Cc1cn(CCCCl)c(=O)c2ccc(Br)cc12.O=P(Cl)(Cl)Cl.
What is the InChIKey of 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride?
The InChIKey is RKWSRKYWJSGSKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrClNO2.Cl3OP/c14-10-2-3-11-12(6-10)9(8-17)7-16(13(11)18)5-1-4-15;1-5(2,3)4/h2-3,6-8H,1,4-5H2;.
What are the key properties of 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride?
6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride has a molecular weight of 481.93 g/mol, XLogP of 6.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(3-chloropropyl)-1-oxoisoquinoline-4-carbaldehyde;phosphoryl trichloride is sourced from PubChem (CID 160654667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).