About [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine
[4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine (PubChem CID 160654941) has the molecular formula C23H23NO
and a molecular weight of 329.44 g/mol. Its IUPAC name is [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine |
| PubChem CID | 160654941 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine |
| SMILES | Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccc(CN)cc3)C2)o1 |
| InChI | InChI=1S/C23H23NO/c1-14-10-19-11-20(22-9-4-15(2)25-22)12-21(19)23(16(14)3)18-7-5-17(13-24)6-8-18/h4-10,12H,11,13,24H2,1-3H3 |
| InChIKey | ACKCLESHTZKOKU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine?
The IUPAC name of [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine (CID 160654941) is [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine.
What is the SMILES notation for [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine?
The canonical SMILES for [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine is Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccc(CN)cc3)C2)o1.
What is the InChIKey of [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine?
The InChIKey is ACKCLESHTZKOKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO/c1-14-10-19-11-20(22-9-4-15(2)25-22)12-21(19)23(16(14)3)18-7-5-17(13-24)6-8-18/h4-10,12H,11,13,24H2,1-3H3.
What are the key properties of [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine?
[4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine has a molecular weight of 329.44 g/mol, XLogP of 5.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5,6-dimethyl-2-(5-methylfuran-2-yl)-1H-inden-4-yl]phenyl]methanamine is sourced from PubChem (CID 160654941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).