C40H51BN2O6 — CID 160655837
tert-butyl 3-[1'-[3-[2-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]propanoate (PubChem CID 160655837) has the molecular formula C40H51BN2O6 and a molecular weight of 666.67 g/mol. Its IUPAC name is tert-butyl 3-[1'-[3-[2-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]propanoate.
| Compound Name | tert-butyl 3-[1'-[3-[2-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]propanoate |
|---|---|
| PubChem CID | 160655837 |
| Molecular Formula | C40H51BN2O6 |
| Molecular Weight | 666.67 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | tert-butyl 3-[1'-[3-[2-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]propanoate |
| SMILES | CN(C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1-c1cccc(C(=O)N2CCC3(CC2)COc2ccc(CCC(=O)OC(C)(C)C)cc23)c1 |
| InChI | InChI=1S/C40H51BN2O6/c1-37(2,3)47-35(44)18-14-27-13-17-34-32(23-27)40(26-46-34)19-21-43(22-20-40)36(45)29-12-10-11-28(24-29)31-25-30(15-16-33(31)42(8)9)41-48-38(4,5)39(6,7)49-41/h10-13,15-17,23-25H,14,18-22,26H2,1-9H3 |
| InChIKey | RLAOGEJFFSBECA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|